Scandoside structure
|
Common Name | Scandoside | ||
|---|---|---|---|---|
| CAS Number | 18842-99-4 | Molecular Weight | 390.33900 | |
| Density | 1.736g/cm3 | Boiling Point | 744.13ºC at 760 mmHg | |
| Molecular Formula | C16H22O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.741ºC | |
Use of ScandosideScandoside is a natural product that can be isolated from iridoid glucosides of Paederia scandens[1]. |
| Name | (1R,4aR,5S,7aR)-5-hydroxy-7-(hydroxymethyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Scandoside is a natural product that can be isolated from iridoid glucosides of Paederia scandens[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.736g/cm3 |
|---|---|
| Boiling Point | 744.13ºC at 760 mmHg |
| Molecular Formula | C16H22O11 |
| Molecular Weight | 390.33900 |
| Flash Point | 271.741ºC |
| Exact Mass | 390.11600 |
| PSA | 186.37000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | ZVXWFPTVHBWJOU-AWQYILTISA-N |
| SMILES | O=C(O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C2C(CO)=CC(O)C12 |
| deacethyl asperulosidic acid |
| desacetyl asperulosidic acid |
| 10-Deacetylasperulosidic acid |
| Deacetylasperulosidic acid |