Feretoside structure
|
Common Name | Feretoside | ||
|---|---|---|---|---|
| CAS Number | 27530-67-2 | Molecular Weight | 404.366 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 696.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H24O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.9±25.0 °C | |
Use of FeretosideFeretoside, a phenolic compound extracted from the barks of E. ulmoides, is a HSP inducer which act as cytoprotective agent. |
| Name | methyl (1S,4aS,5R,7aS)-5-hydroxy-7-(hydroxymethyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Feretoside, a phenolic compound extracted from the barks of E. ulmoides, is a HSP inducer which act as cytoprotective agent. |
|---|---|
| Related Catalog | |
| Target |
HSP[1] |
| In Vitro | The barks of Eucommia ulmoides (Eucommiae Cortex, Eucommiaceae) have been used as a traditional medicine in Korea, Japan, and China to treat hypertension, reinforce the muscles and bones, and recover the damaged liver and kidney functions. Feretoside increases expression of HSF1 by a factor of 1.214, 1.144, 1.153, 1.114, 1.159, 1.041, and 1.167 at 3 mm, respectively[1]. |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 696.3±55.0 °C at 760 mmHg |
| Molecular Formula | C17H24O11 |
| Molecular Weight | 404.366 |
| Flash Point | 250.9±25.0 °C |
| Exact Mass | 404.131866 |
| PSA | 175.37000 |
| LogP | -2.72 |
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | WSGPLSDARZNMCW-LPGRTNKPSA-N |
| SMILES | COC(=O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C2C(CO)=CC(O)C12 |
| Hazard Codes | Xi |
|---|
| Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxy-7-(hydroxymethyl)-, methyl ester, (1S,4aS,5R,7aS)- |
| 6β-hydroxygeniposide |
| Scandoside methyl ester |
| desacetylasperulosidic acid methyl ester |
| methyl deacetylasperulosidate |
| Methyl (1S,4aS,5R,7aS)-1-(β-D-glucopyranosyloxy)-5-hydroxy-7-(hydroxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| 6beta-hydroxygeniposide |
| deacetyl asperulosidic acid |
| 10-O-deacetylasperulosidic acid methyl ester |
| I07-0201 |
| deacetylasperulosidic acid methyl ester |
| Feretoside |