4-Methoxyphthalic acid structure
|
Common Name | 4-Methoxyphthalic acid | ||
|---|---|---|---|---|
| CAS Number | 1885-13-8 | Molecular Weight | 196.157 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 394.0±27.0 °C at 760 mmHg | |
| Molecular Formula | C9H8O5 | Melting Point | 173-175ºC(lit.) | |
| MSDS | N/A | Flash Point | 162.9±17.2 °C | |
| Name | 4-Methoxyphthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.0±27.0 °C at 760 mmHg |
| Melting Point | 173-175ºC(lit.) |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.157 |
| Flash Point | 162.9±17.2 °C |
| Exact Mass | 196.037170 |
| PSA | 83.83000 |
| LogP | 1.09 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | JKZSIEDAEHZAHQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)O)c(C(=O)O)c1 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,2-Benzenedicarboxylic acid, 4-methoxy- |
| 4-methoxy-1,2-benzenedicarboxylic acid |
| 4-Methoxyphthalicacid |
| 4-Methoxyphthalsaeure |
| 4-Methoxy-o-phthalsaeure-x-<14C> |
| EINECS 217-546-2 |
| MFCD00094739 |
| 4-Methoxyphthalic acid |