ETHYL ALPHA-CYANO-4-FLUOROCINNAMATE structure
|
Common Name | ETHYL ALPHA-CYANO-4-FLUOROCINNAMATE | ||
|---|---|---|---|---|
| CAS Number | 18861-57-9 | Molecular Weight | 219.21200 | |
| Density | 1.212g/cm3 | Boiling Point | 330.7ºC at 760mmHg | |
| Molecular Formula | C12H10FNO2 | Melting Point | 96-100ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 153.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Ethyl α-cyano-4-fluorocinnamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 330.7ºC at 760mmHg |
| Melting Point | 96-100ºC(lit.) |
| Molecular Formula | C12H10FNO2 |
| Molecular Weight | 219.21200 |
| Flash Point | 153.8ºC |
| Exact Mass | 219.07000 |
| PSA | 50.09000 |
| LogP | 2.29578 |
| Vapour Pressure | 0.000164mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | OSTPLWBGNXWIBG-JXMROGBWSA-N |
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22 |
| Safety Phrases | 36 |
| RIDADR | NONH for all modes of transport |
|
~97%
ETHYL ALPHA-CYA... CAS#:18861-57-9 |
| Literature: Trilla, Montserrat; Pleixats, Roser; Man, Michel Wong Chi; Bied, Catherine Green Chemistry, 2009 , vol. 11, # 11 p. 1815 - 1820 |
|
~91%
ETHYL ALPHA-CYA... CAS#:18861-57-9 |
| Literature: Shen, Yanchang; Yang, Baozhen Synthetic Communications, 1989 , vol. 19, # 17 p. 3069 - 3076 |
|
~0%
Detail
|
| Literature: Xu, Hui; Yu, Xinhong; Sun, Leying; Liu, Jing; Fan, Wen; Shen, Yongjia; Wang, Wei Tetrahedron Letters, 2008 , vol. 49, # 32 p. 4687 - 4689 |
| 2-Cyano-3-(4-fluorophenyl)propenoic acid ethyl ester |
| MFCD00176412 |
| ethyl 2-cyano-3-(4-fluoro)phenyl-2-propenoate |
| 4-Fluorobenzylidenecyanoacetic acid ethyl ester |
| ethyl 2-cyano-3-(4-fluorophenyl)prop-2-enecarboxylate |
| 2-cyano-3-(4-fluorophenyl)-acrylic acid ethyl ester |
| EINECS 242-633-7 |
| ethyl 2-cyano-3-(4-fluorophenyl)acrylate |
| ethyl 4-fluorobenzalcyanoacetate |