(3-Methoxybenzyl)(triphenyl)phosphonium chloride structure
|
Common Name | (3-Methoxybenzyl)(triphenyl)phosphonium chloride | ||
|---|---|---|---|---|
| CAS Number | 18880-05-2 | Molecular Weight | 418.895 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24ClOP | Melting Point | 268 °C(dec.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-methoxyphenyl)methyl-triphenylphosphanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 268 °C(dec.) |
|---|---|
| Molecular Formula | C26H24ClOP |
| Molecular Weight | 418.895 |
| Exact Mass | 418.125336 |
| PSA | 22.82000 |
| LogP | 2.19330 |
| InChIKey | DPYDLIVUYPUXBV-UHFFFAOYSA-M |
| SMILES | COc1cccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1.[Cl-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2931900090 |
|
~97%
(3-Methoxybenzy... CAS#:18880-05-2 |
| Literature: Colabufo, Nicola Antonio; Berardi, Francesco; Perrone, Roberto; Rapposelli, Simona; Digiacomo, Maria; Balsamo, Aldo Journal of Medicinal Chemistry, 2006 , vol. 49, # 22 p. 6607 - 6613 |
|
~%
(3-Methoxybenzy... CAS#:18880-05-2 |
| Literature: Journal of Chemical Research, , # 3 p. 232 - 233 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (3-Methoxybenzyl)triphenylphosphonium Chloride |
| m-methoxybenzyltriphenylphosphonium chloride |
| Phosphonium, [(3-methoxyphenyl)methyl]triphenyl-, chloride (1:1) |
| 3-Methoxybenzyltriphenylphosphonium Chloride |
| (3-Methoxybenzyl)(triphenyl)phosphonium chloride |
| 3-methoxybenzyl(chloro)triphenylphosphorane |
| 3-methoxybenzyl(chloro)triphenyphosphine |
| (3-methoxyphenyl)methyl-triphenyl-phosphanium Chloride |
| ((3-methoxyphenyl)methyl)triphenylphosphonium chloride |