2-[4-(2-chloro-2-oxoethoxy)phenoxy]acetyl chloride structure
|
Common Name | 2-[4-(2-chloro-2-oxoethoxy)phenoxy]acetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1889-01-6 | Molecular Weight | 263.07400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(2-chloro-2-oxoethoxy)phenoxy]acetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8Cl2O4 |
|---|---|
| Molecular Weight | 263.07400 |
| Exact Mass | 261.98000 |
| PSA | 52.60000 |
| LogP | 1.97500 |
| InChIKey | FUWCOOOJEXYFSD-UHFFFAOYSA-N |
| SMILES | O=C(Cl)COc1ccc(OCC(=O)Cl)cc1 |
|
~91%
2-[4-(2-chloro-... CAS#:1889-01-6 |
| Literature: Wei, Taibao; Chen, Jichou; Wang, Xicun; Zhang, Youming; Wang, Lailai Synthetic Communications, 1996 , vol. 26, # 7 p. 1447 - 1454 |
|
~%
2-[4-(2-chloro-... CAS#:1889-01-6 |
| Literature: Kyte, Andrew B.; Owens, Ken A.; Sutherland, Ian O.; Newton, Roger F. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 1921 - 1928 |
|
~%
2-[4-(2-chloro-... CAS#:1889-01-6 |
| Literature: Bischoff; Froehlich Chemische Berichte, 1907 , vol. 40, p. 2781 |
|
~%
2-[4-(2-chloro-... CAS#:1889-01-6 |
| Literature: Bezwada Biomedical, LLC Patent: US8053591 B2, 2011 ; |
| p-phenylenedioxydi-acetyl chloride |
| 1,4-phenylenedioxydiacetic chloride |
| p-Phenylendioxydi-acetylchlorid |
| p-phenylenedioxyacetyl dichloride |