methyl 2-[4-(2-methoxy-2-oxoethoxy)phenoxy]acetate structure
|
Common Name | methyl 2-[4-(2-methoxy-2-oxoethoxy)phenoxy]acetate | ||
|---|---|---|---|---|
| CAS Number | 80791-19-1 | Molecular Weight | 254.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[4-(2-methoxy-2-oxoethoxy)phenoxy]acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O6 |
|---|---|
| Molecular Weight | 254.23600 |
| Exact Mass | 254.07900 |
| PSA | 71.06000 |
| LogP | 0.79020 |
| InChIKey | ILUGKFJEEHCOJJ-UHFFFAOYSA-N |
| SMILES | COC(=O)COc1ccc(OCC(=O)OC)cc1 |
|
~93%
methyl 2-[4-(2-... CAS#:80791-19-1 |
| Literature: Wei, Tai-Bao; Liu, Hong; Li, Man-Lin; Zhang, You-Ming Synthetic Communications, 2005 , vol. 35, # 13 p. 1759 - 1764 |
|
~76%
methyl 2-[4-(2-... CAS#:80791-19-1 |
| Literature: Gryko, Daniel T.; Piatek, Piotr; Jurczak, Janusz Tetrahedron, 1997 , vol. 53, # 23 p. 7957 - 7966 |
|
~%
methyl 2-[4-(2-... CAS#:80791-19-1 |
| Literature: Soper et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 2849,2851 |
| dimethyl 1,4-phenylenedioxyacetate |
| (4-Methoxycarbonylmethoxy-phenoxy)-acetic acid,methyl ester |
| methyl 2-<4-<(methoxycarbonyl)methoxy>phenoxy> acetate |
| p-phenylenedioxydi-acetic acid dimethyl ester |
| p-Phenylendioxydi-essigsaeure-dimethylester |
| 1,4-bis(methyloxycarbonylmethylenoxy)benzene |
| 1,4-bis(methoxycarbonylmethoxy)benzene |
| Bis-O-methoxycarbonylmethyl-hydrochinon |