1-(4-hexanoylpiperazin-1-yl)hexan-1-one structure
|
Common Name | 1-(4-hexanoylpiperazin-1-yl)hexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 18903-09-8 | Molecular Weight | 282.42200 | |
| Density | 0.997g/cm3 | Boiling Point | 452.8ºC at 760 mmHg | |
| Molecular Formula | C16H30N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.2ºC | |
| Name | 1-(4-hexanoylpiperazin-1-yl)hexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.997g/cm3 |
|---|---|
| Boiling Point | 452.8ºC at 760 mmHg |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.42200 |
| Flash Point | 191.2ºC |
| Exact Mass | 282.23100 |
| PSA | 40.62000 |
| LogP | 2.69360 |
| Vapour Pressure | 2.18E-08mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | FDZTWQOEIFKHDA-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)N1CCN(C(=O)CCCCC)CC1 |
|
~80%
1-(4-hexanoylpi... CAS#:18903-09-8 |
| Literature: Srimani, Dipankar; Balaraman, Ekambaram; Hu, Peng; Ben-David, Yehoshoa; Milstein, David Advanced Synthesis and Catalysis, 2013 , vol. 355, # 13 p. 2525 - 2530 |
|
~%
1-(4-hexanoylpi... CAS#:18903-09-8 |
| Literature: Groszkowski et al. Annales Pharmaceutiques Francaises, 1958 , vol. 16, p. 517,522, 524 |
| 1,4-Dihexanoylpiperazine |
| Piperazine,1,4-dihexanoyl |
| 1,1'-piperazine-1,4-diyldihexan-1-one |
| 1,4-Dihexanoyl-piperazin |