2-Methyl-6-((phenylsulfonyl)oxy)[1,3]thiazolo[4,5-d]pyrimidine-5,7(4H,6H)-dione structure
|
Common Name | 2-Methyl-6-((phenylsulfonyl)oxy)[1,3]thiazolo[4,5-d]pyrimidine-5,7(4H,6H)-dione | ||
|---|---|---|---|---|
| CAS Number | 18903-25-8 | Molecular Weight | 339.34700 | |
| Density | 1.72g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H9N3O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-methyl-5,7-dioxo-4H-[1,3]thiazolo[4,5-d]pyrimidin-6-yl) benzenesulfonate |
|---|
| Density | 1.72g/cm3 |
|---|---|
| Molecular Formula | C12H9N3O5S2 |
| Molecular Weight | 339.34700 |
| Exact Mass | 338.99800 |
| PSA | 147.74000 |
| LogP | 1.35300 |
| Index of Refraction | 1.718 |
| InChIKey | CIARDSLDNCFBMB-UHFFFAOYSA-N |
| SMILES | Cc1nc2[nH]c(=O)n(OS(=O)(=O)c3ccccc3)c(=O)c2s1 |
|
~%
2-Methyl-6-((ph... CAS#:18903-25-8 |
| Literature: Bauer,L.; Mahajanshetti,C.S. Journal of Heterocyclic Chemistry, 1968 , vol. 5, p. 331 - 335 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |