Diethyl 2-methylthiazole-4,5-dicarboxylate
Modify Date: 2025-08-24 21:37:24
Diethyl 2-methylthiazole-4,5-dicarboxylate structure
|
Common Name | Diethyl 2-methylthiazole-4,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 18903-17-8 | Molecular Weight | 243.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-methyl-1,3-thiazole-4,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13NO4S |
|---|---|
| Molecular Weight | 243.28000 |
| Exact Mass | 243.05700 |
| PSA | 93.73000 |
| LogP | 1.80490 |
| InChIKey | AYIRUTZHPSMMAW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nc(C)sc1C(=O)OCC |
| HS Code | 2934100090 |
|---|
|
~%
Diethyl 2-methy... CAS#:18903-17-8 |
| Literature: Bauer,L.; Mahajanshetti,C.S. Journal of Heterocyclic Chemistry, 1968 , vol. 5, p. 331 - 335 |
![2-Methyl-6-((phenylsulfonyl)oxy)[1,3]thiazolo[4,5-d]pyrimidine-5,7(4H,6H)-dione structure](https://image.chemsrc.com/caspic/322/18903-25-8.png)
CAS#:18903-25-8![6-hydroxy-2-methyl-4H-thiazolo[5,4-d]pyrimidine-5,7-dione structure](https://image.chemsrc.com/caspic/360/18903-24-7.png)
CAS#:18903-24-7![4-hydroxy-8-methyl-7-thia-2,4,9-triazabicyclo[4.3.0]nona-8,10-diene-3,5-dione structure](https://image.chemsrc.com/caspic/398/18903-23-6.png)
CAS#:18903-23-6![8-methyl-7-thia-2,4,9-triazabicyclo[4.3.0]nona-8,10-diene-3,5-dione structure](https://image.chemsrc.com/caspic/284/18903-26-9.png)
CAS#:18903-26-9![8-methyl-9-thia-3,4,7-triazabicyclo[4.3.0]nona-7,10-diene-2,5-dione structure](https://image.chemsrc.com/caspic/116/7464-12-2.png)
CAS#:7464-12-2| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Methylthiazole-4,5-dicarboxylic acid diethyl ester |
| 2-Methyl-thiazol-dicarbonsaeure-(4,5)-diethylester |
| 4,5-Thiazoledicarboxylicacid,2-methyl-,4,5-diethyl ester |