2-chloro-1-methyl-3,5-dinitro-benzene structure
|
Common Name | 2-chloro-1-methyl-3,5-dinitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 18905-50-5 | Molecular Weight | 216.57900 | |
| Density | 1.532g/cm3 | Boiling Point | 337.4ºC at 760 mmHg | |
| Molecular Formula | C7H5ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.8ºC | |
| Name | 2-chloro-1-methyl-3,5-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.532g/cm3 |
|---|---|
| Boiling Point | 337.4ºC at 760 mmHg |
| Molecular Formula | C7H5ClN2O4 |
| Molecular Weight | 216.57900 |
| Flash Point | 157.8ºC |
| Exact Mass | 215.99400 |
| PSA | 91.64000 |
| LogP | 3.51120 |
| Vapour Pressure | 0.000206mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | FXMUNKFQIKDUBF-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Cl |
| HS Code | 2904909090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-chloro-1-methyl-3,5-dinitro-benzene |
| 2-methyl-4,6-dinitrochlorobenzene |
| 1-chloro-2-methyl-4,6-dinitrobenzene |
| 2-Methyl-4,6-dinitro-chlorbenzol |
| 2,4-Dinitro-1-chlor-6-methyl-benzol |
| 2-Chlor-3,5-dinitro-toluol |
| 2-Chloro-3,5-dinitrotoluene |