2-methyl-4,6-dinitro-aniline structure
|
Common Name | 2-methyl-4,6-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 7477-94-3 | Molecular Weight | 197.14800 | |
| Density | 1.497g/cm3 | Boiling Point | 416.8ºC at 760 mmHg | |
| Molecular Formula | C7H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.9ºC | |
| Name | 2-methyl-4,6-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.497g/cm3 |
|---|---|
| Boiling Point | 416.8ºC at 760 mmHg |
| Molecular Formula | C7H7N3O4 |
| Molecular Weight | 197.14800 |
| Flash Point | 205.9ºC |
| Exact Mass | 197.04400 |
| PSA | 117.66000 |
| LogP | 3.02120 |
| Index of Refraction | 1.656 |
| InChIKey | CUUJSCZRXAFXIP-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N |
| HS Code | 2921430090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-methyl-4,6-dinitro-aniline |
| 3.5-Dinitro-2-amino-toluol |
| 6-methyl-2,4-dinitrobenzenamine |
| 4.6-Dinitro-o-toluidin |
| 2-Methyl-4,6-dinitro-anilin |
| m.m-Dinitro-o-toluidin |