Benzenepropanoic acid,4-acetyl-a-bromo- structure
|
Common Name | Benzenepropanoic acid,4-acetyl-a-bromo- | ||
|---|---|---|---|---|
| CAS Number | 18910-19-5 | Molecular Weight | 271.10700 | |
| Density | 1.519g/cm3 | Boiling Point | 389.5ºC at 760mmHg | |
| Molecular Formula | C11H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.4ºC | |
| Name | 3-(4-acetylphenyl)-2-bromopropanoic acid |
|---|
| Density | 1.519g/cm3 |
|---|---|
| Boiling Point | 389.5ºC at 760mmHg |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.10700 |
| Flash Point | 189.4ºC |
| Exact Mass | 269.98900 |
| PSA | 54.37000 |
| LogP | 2.27980 |
| Vapour Pressure | 9.15E-07mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | OTXNYZKECLXPSN-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(CC(Br)C(=O)O)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
Benzenepropanoi... CAS#:18910-19-5 |
| Literature: Doyle,M.P. et al. Journal of Organic Chemistry, 1977 , vol. 42, p. 2431 - 2436 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |