2-(4-Nitrophenyl)malondialdehyde structure
|
Common Name | 2-(4-Nitrophenyl)malondialdehyde | ||
|---|---|---|---|---|
| CAS Number | 18915-53-2 | Molecular Weight | 193.15600 | |
| Density | 1.323g/cm3 | Boiling Point | 333.3ºC at 760 mmHg | |
| Molecular Formula | C9H7NO4 | Melting Point | 231-233(dec.)ºC | |
| MSDS | N/A | Flash Point | 164.5ºC | |
| Name | 2-(4-Nitrophenyl)malondialdehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 333.3ºC at 760 mmHg |
| Melting Point | 231-233(dec.)ºC |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.15600 |
| Flash Point | 164.5ºC |
| Exact Mass | 193.03800 |
| PSA | 79.96000 |
| LogP | 1.59940 |
| Vapour Pressure | 0.000138mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | AXZKOZLDEWIJPX-UHFFFAOYSA-N |
| SMILES | O=CC(C=O)c1ccc([N+](=O)[O-])cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2913000090 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 2-(4-nitrophenyl)propanedial |