4-(4-methylphenyl)hepta-1,6-dien-4-amine structure
|
Common Name | 4-(4-methylphenyl)hepta-1,6-dien-4-amine | ||
|---|---|---|---|---|
| CAS Number | 189167-67-7 | Molecular Weight | 201.30700 | |
| Density | 0.932g/cm3 | Boiling Point | 297.6ºC at 760 mmHg | |
| Molecular Formula | C14H19N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.5ºC | |
| Name | 4-(4-methylphenyl)hepta-1,6-dien-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.932g/cm3 |
|---|---|
| Boiling Point | 297.6ºC at 760 mmHg |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.30700 |
| Flash Point | 123.5ºC |
| Exact Mass | 201.15200 |
| PSA | 26.02000 |
| LogP | 4.00150 |
| Vapour Pressure | 0.00134mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | HEGIGPOCFFGRKR-UHFFFAOYSA-N |
| SMILES | C=CCC(N)(CC=C)c1ccc(C)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921499090 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-(4-methylphenyl)hepta-1,6-dien-4-ylamine |
| 1-Allyl-1-p-tolyl-but-3-enylamine |