3-Hexanone,4,4-bis[4-(acetyloxy)phenyl]- structure
|
Common Name | 3-Hexanone,4,4-bis[4-(acetyloxy)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 18922-12-8 | Molecular Weight | 368.42300 | |
| Density | 1.134g/cm3 | Boiling Point | 480.9ºC at 760mmHg | |
| Molecular Formula | C22H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208ºC | |
| Name | [4-[3-(4-acetyloxyphenyl)-4-oxohexan-3-yl]phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 480.9ºC at 760mmHg |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.42300 |
| Flash Point | 208ºC |
| Exact Mass | 368.16200 |
| PSA | 69.67000 |
| LogP | 4.21240 |
| Vapour Pressure | 2.08E-09mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | IKCMGESKFZLMGO-UHFFFAOYSA-N |
| SMILES | CCC(=O)C(CC)(c1ccc(OC(C)=O)cc1)c1ccc(OC(C)=O)cc1 |
|
~%
3-Hexanone,4,4-... CAS#:18922-12-8 |
| Literature: Lane; Spialter Journal of the American Chemical Society, 1951 , vol. 73, p. 4408 |
|
~%
3-Hexanone,4,4-... CAS#:18922-12-8 |
| Literature: v. Wessely et al. Monatshefte fuer Chemie, 1941 , vol. 73, p. 127,158 |
| UNII-JKF544U9RP |
| 4,4-Bis-(4-acetoxy-phenyl)-hexan-3-on |
| 4,4-Bis[4-(acetyloxy)phenyl]3-hexanone |
| 4,4-Bis(p-acetoxyphenyl)-3-hexanone |
| 4,4-bis-(4-acetoxy-phenyl)-hexan-3-one |
| 3,3-Bis-<4-acetoxyphenyl>-hexanon-(4) |