CHEMBRDG-BB 5101460 structure
|
Common Name | CHEMBRDG-BB 5101460 | ||
|---|---|---|---|---|
| CAS Number | 189250-15-5 | Molecular Weight | 235.67300 | |
| Density | 1.441g/cm3 | Boiling Point | 496.1ºC at 760 mmHg | |
| Molecular Formula | C10H10ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.9ºC | |
| Name | N-benzyl-6-chloro-1,3,5-triazine-2,4-diaMine |
|---|
| Density | 1.441g/cm3 |
|---|---|
| Boiling Point | 496.1ºC at 760 mmHg |
| Molecular Formula | C10H10ClN5 |
| Molecular Weight | 235.67300 |
| Flash Point | 253.9ºC |
| Exact Mass | 235.06200 |
| PSA | 76.72000 |
| LogP | 2.37350 |
| Vapour Pressure | 5.55E-10mmHg at 25°C |
| Index of Refraction | 1.708 |
| InChIKey | XSDWOOUKAMFWTM-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cl)nc(NCc2ccccc2)n1 |
| HS Code | 2933699090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |