6-Bromo-1-[(4-methylphenyl)sulfonyl]-1H-indole structure
|
Common Name | 6-Bromo-1-[(4-methylphenyl)sulfonyl]-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 189265-99-4 | Molecular Weight | 350.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-Bromo-1-[(4-methylphenyl)sulfonyl]-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12BrNO2S |
|---|---|
| Molecular Weight | 350.23000 |
| Exact Mass | 348.97700 |
| PSA | 47.45000 |
| LogP | 5.03000 |
| InChIKey | RIORRJLLXUYLTE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3ccc(Br)cc32)cc1 |
|
~95%
6-Bromo-1-[(4-m... CAS#:189265-99-4 |
| Literature: Garg, Neil K.; Sarpong, Richmond; Stoltz, Brian M. Journal of the American Chemical Society, 2002 , vol. 124, # 44 p. 13179 - 13184 |
|
~91%
6-Bromo-1-[(4-m... CAS#:189265-99-4 |
| Literature: Fresneda, Pilar M.; Molina, Pedro; Delgado, Santiago; Bleda, Juan A. Tetrahedron Letters, 2000 , vol. 41, # 24 p. 4777 - 4780 |
| 6-bromo-1-tolueneslufonyl-1H-indole |
| N-tosyl-3-bromoindole |
| 1-tosyl-6-bromoindole |
| N-tosyl-6-bromoindole |