[2,2-Bis(trimethylsilyl)vinyl](trimethyl)silane structure
|
Common Name | [2,2-Bis(trimethylsilyl)vinyl](trimethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 18938-24-4 | Molecular Weight | 244.59700 | |
| Density | 0.787g/cm3 | Boiling Point | 199.9ºC at 760mmHg | |
| Molecular Formula | C11H28Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 40.6ºC | |
| Name | 1,2-bis(trimethylsilyl)ethenyl-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.787g/cm3 |
|---|---|
| Boiling Point | 199.9ºC at 760mmHg |
| Molecular Formula | C11H28Si3 |
| Molecular Weight | 244.59700 |
| Flash Point | 40.6ºC |
| Exact Mass | 244.15000 |
| LogP | 4.54500 |
| Vapour Pressure | 0.471mmHg at 25°C |
| Index of Refraction | 1.422 |
| InChIKey | CUFNUQSBSOKXJH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C=C([Si](C)(C)C)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tris-trimethylsilyl-aethylen |
| Tris-<trimethylsilyl>-ethylen |