(2,4,5-trichlorophenyl) 2-methylprop-2-enoate structure
|
Common Name | (2,4,5-trichlorophenyl) 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 18967-28-7 | Molecular Weight | 265.52000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,4,5-trichlorophenyl) 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7Cl3O2 |
|---|---|
| Molecular Weight | 265.52000 |
| Exact Mass | 263.95100 |
| PSA | 26.30000 |
| LogP | 4.12830 |
| InChIKey | LADVVLNKOIYKBB-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)Oc1cc(Cl)c(Cl)cc1Cl |
|
~83%
(2,4,5-trichlor... CAS#:18967-28-7 |
| Literature: Gorchakova; Budzan; Andronova; Kolokolov; Virnik Journal of applied chemistry of the USSR, 1984 , vol. 57, # 5 pt 2 p. 1038 - 1041 |
| 2-Propenoic acid,2-methyl-,2,4,5-trichlorophenyl ester |
| 2,4,5-Trichlorphenylmethacrylat |