Akuammiline structure
|
Common Name | Akuammiline | ||
|---|---|---|---|---|
| CAS Number | 1897-26-3 | Molecular Weight | 394.464 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 511.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.0±30.1 °C | |
Use of AkuammilineAkuammiline, compound 2, is isolated from isolated from the seeds of Picralima klaineana[1]. |
| Name | 2,5-Bis(trifluoromethyl)-1,3,4-oxadiazole |
|---|---|
| Synonym | More Synonyms |
| Description | Akuammiline, compound 2, is isolated from isolated from the seeds of Picralima klaineana[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 511.2±50.0 °C at 760 mmHg |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.464 |
| Flash Point | 263.0±30.1 °C |
| Exact Mass | 394.189270 |
| PSA | 68.20000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | QBHALCZZZWCCLV-AATGQAFQSA-N |
| SMILES | CC=C1CN2CCC34C(=Nc5ccccc53)C2CC1C4(COC(C)=O)C(=O)OC |
| Hazard Codes | Xi |
|---|
| 2H-2,7a-Methanoindolo[2,3-a]quinolizine-13-carboxylic acid, 13-[(acetyloxy)methyl]-3-ethylidene-1,3,4,6,7,12b-hexahydro-, methyl ester, (3E,7aS,12bS)- |
| Methyl (16ξ,19E)-17-acetoxyakuammilan-16-carboxylate |