Benzene,2,4-dichloro-1-(2-nitroethenyl)- structure
|
Common Name | Benzene,2,4-dichloro-1-(2-nitroethenyl)- | ||
|---|---|---|---|---|
| CAS Number | 18984-21-9 | Molecular Weight | 218.03700 | |
| Density | 1.447g/cm3 | Boiling Point | 334.1ºC at 760mmHg | |
| Molecular Formula | C8H5Cl2NO2 | Melting Point | 115-119 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 155.9ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 2,4-DICHLORO-ω-NITROSTYRENE |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 334.1ºC at 760mmHg |
| Melting Point | 115-119 °C(lit.) |
| Molecular Formula | C8H5Cl2NO2 |
| Molecular Weight | 218.03700 |
| Flash Point | 155.9ºC |
| Exact Mass | 216.97000 |
| PSA | 45.82000 |
| LogP | 3.76400 |
| Vapour Pressure | 0.000253mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | LIWIJBBAMBDXME-ONEGZZNKSA-N |
| SMILES | O=[N+]([O-])C=Cc1ccc(Cl)cc1Cl |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319-H400 |
| Precautionary Statements | P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn,N,Xi |
| Risk Phrases | R22 |
| Safety Phrases | S26-S36-S60-S61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(2,4-DICHLOROPHENYL)-2-NITROETHENE |
| 1-(2,4-DICHLOROPHENYL)-2-NITROETHYLENE |
| Benzene,2,4-dichloro-1-(2-nitroethenyl) |
| MFCD00053063 |
| 2,4-dichloro-1-(2-nitrovinyl)benzene |
| 2,4-dichloro-nitrostyrene |
| 2,4-Dichloro-1-(2-Nitroethenyl)-Benzene |
| 2-Nitro-1-(2,4-dichlor-phenyl)-ethylen |
| trans-2,4-Dichloro-β-nitrostyrene |