3-p-Coumaroylquinic acid structure
|
Common Name | 3-p-Coumaroylquinic acid | ||
|---|---|---|---|---|
| CAS Number | 1899-30-5 | Molecular Weight | 338.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-p-Coumaroylquinic acid3-p-Coumaroylquinic acid (compound 3a) is an isomer of p-coumaroylquinic acid[1]. |
| Name | 5-p-coumaroylquinic acid |
|---|
| Description | 3-p-Coumaroylquinic acid (compound 3a) is an isomer of p-coumaroylquinic acid[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H18O8 |
|---|---|
| Molecular Weight | 338.30900 |
| Exact Mass | 338.10000 |
| PSA | 144.52000 |
| InChIKey | BMRSEYFENKXDIS-OTCYKTEZSA-N |
| SMILES | O=C(C=Cc1ccc(O)cc1)OC1CC(O)(C(=O)O)CC(O)C1O |
| Precursor 0 | |
|---|---|
| DownStream 2 | |