campesterol acetate
campesterol acetate structure
|
Common Name | campesterol acetate | ||
|---|---|---|---|---|
| CAS Number | 1900-53-4 | Molecular Weight | 442.71700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H50O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 24(R)-24-methyl-5-cholesten-3β-yl acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H50O2 |
|---|---|
| Molecular Weight | 442.71700 |
| Exact Mass | 442.38100 |
| PSA | 26.30000 |
| LogP | 8.20550 |
| InChIKey | JOBAYBRAHVTSSW-NTUCOQBPSA-N |
| SMILES | CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCC(C)C(C)C)CCC32)C1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:474-62-4
CAS#:474-60-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 24(R)-24-methyl-5-cholesten-3β-yl acetate? |
| A: The English name of 24(R)-24-methyl-5-cholesten-3β-yl acetate is 24(R)-24-methyl-5-cholesten-3β-yl acetate. |
| Q: What are the downstream products of 24(R)-24-methyl-5-cholesten-3β-yl acetate? |
| A: Related downstream products(CAS) of 24(R)-24-methyl-5-cholesten-3β-yl acetate: 474-62-4;474-60-2. |
| Q: What is the polar surface area (PSA) of 24(R)-24-methyl-5-cholesten-3β-yl acetate? |
| A: Polar surface area (PSA) of 24(R)-24-methyl-5-cholesten-3β-yl acetate is 26.30000. |
| Q: What is the CAS number of 24(R)-24-methyl-5-cholesten-3β-yl acetate? |
| A: CAS number of 24(R)-24-methyl-5-cholesten-3β-yl acetate is 1900-53-4. |
| Q: What is the Chinese name of 1900-53-4? |
| A: Chinese name of 1900-53-4 is 1900-53-4. |
| Q: What is the InChIKey of 24(R)-24-methyl-5-cholesten-3β-yl acetate? |
| A: InChIKey of 24(R)-24-methyl-5-cholesten-3β-yl acetate is JOBAYBRAHVTSSW-NTUCOQBPSA-N. |
| Q: What is the SMILES notation of 24(R)-24-methyl-5-cholesten-3β-yl acetate? |
| A: SMILES notation of 24(R)-24-methyl-5-cholesten-3β-yl acetate is CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCC(C)C(C)C)CCC32)C1. |
| Q: What is the molecular weight of 24(R)-24-methyl-5-cholesten-3β-yl acetate? |
| A: Molecular weight of 24(R)-24-methyl-5-cholesten-3β-yl acetate is 442.71700. |
| Q: What is the LogP of 24(R)-24-methyl-5-cholesten-3β-yl acetate? |
| A: LogP of 24(R)-24-methyl-5-cholesten-3β-yl acetate is 8.20550. |
| Q: What is the molecular formula of 24(R)-24-methyl-5-cholesten-3β-yl acetate? |
| A: Molecular formula of 24(R)-24-methyl-5-cholesten-3β-yl acetate is C30H50O2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |