4-tert-butyl-1,1-diethoxycyclohexane structure
|
Common Name | 4-tert-butyl-1,1-diethoxycyclohexane | ||
|---|---|---|---|---|
| CAS Number | 1900-58-9 | Molecular Weight | 228.37100 | |
| Density | 0.89g/cm3 | Boiling Point | 267.5ºC at 760 mmHg | |
| Molecular Formula | C14H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 78.3ºC | |
| Name | 4-tert-butyl-1,1-diethoxycyclohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.89g/cm3 |
|---|---|
| Boiling Point | 267.5ºC at 760 mmHg |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.37100 |
| Flash Point | 78.3ºC |
| Exact Mass | 228.20900 |
| PSA | 18.46000 |
| LogP | 3.99200 |
| Vapour Pressure | 0.0134mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | QTSXNUWFLGKEKB-UHFFFAOYSA-N |
| SMILES | CCOC1(OCC)CCC(C(C)(C)C)CC1 |
| HS Code | 2911000000 |
|---|
| HS Code | 2911000000 |
|---|---|
| Summary | 2911000000 acetals and hemiacetals, whether or not with other oxygen function, and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-tert.-Butyl-cyclohexanon-diethylketal |
| 4-t-butylcyclohexanone diethyl acetal |
| 1.1-Diaethoxy-4-tert.-butylcyclohexan |
| 4-tert.-Butyl-cyclohexan-1-on-diethylketal |
| 4-t-Butylcyclohexanondiethylketal |
| 4-(tert-butyl)-1,1-diethoxycyclohexane |
| 4-tert-Butylcyclohexanone diethyl acetal |
| 1,1-diethoxy-4-tert-butylcyclohexanone |
| 4-t-Butylcyclohexanone diethyl ketal |