Z-AC4C-OH structure
|
Common Name | Z-AC4C-OH | ||
|---|---|---|---|---|
| CAS Number | 190004-53-6 | Molecular Weight | 249.26200 | |
| Density | 1.29g/cm3 | Boiling Point | 458.2ºC at 760mmHg | |
| Molecular Formula | C13H15NO4 | Melting Point | 83-87ºC | |
| MSDS | N/A | Flash Point | 230.9ºC | |
| Name | 1-(phenylmethoxycarbonylamino)cyclobutane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 458.2ºC at 760mmHg |
| Melting Point | 83-87ºC |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.26200 |
| Flash Point | 230.9ºC |
| Exact Mass | 249.10000 |
| PSA | 75.63000 |
| LogP | 2.31100 |
| Vapour Pressure | 3.43E-09mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | GDJSFBNRXFOUEQ-UHFFFAOYSA-N |
| SMILES | O=C(NC1(C(=O)O)CCC1)OCc1ccccc1 |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | 26-36 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(((Benzyloxy)carbonyl)amino)cyclobutanecarboxylic acid |
| 1-(Z-amino)cyclobutanecarboxylic acid |
| Z-cyclovaline |