4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione
4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione structure
|
Common Name | 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 190020-14-5 | Molecular Weight | 322.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H13F3O3 |
|---|---|
| Molecular Weight | 322.27900 |
| Exact Mass | 322.08200 |
| PSA | 43.37000 |
| LogP | 3.96980 |
| InChIKey | ICPXKFWSKKAXBH-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(OCc2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~96%
4,4,4-trifluoro... CAS#:190020-14-5 |
| Literature: G.D. Searle and Co. Patent: US6045773 A1, 2000 ; |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 190020-14-5? |
| A: Chinese name of 190020-14-5 is 190020-14-5. |
| Q: What is the SMILES notation of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione? |
| A: SMILES notation of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione is O=C(CC(=O)C(F)(F)F)c1ccc(OCc2ccccc2)cc1. |
| Q: What is the molecular weight of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione? |
| A: Molecular weight of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione is 322.27900. |
| Q: What is the molecular formula of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione? |
| A: Molecular formula of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione is C17H13F3O3. |
| Q: What is the CAS number of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione? |
| A: CAS number of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione is 190020-14-5. |
| Q: What is the InChIKey of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione? |
| A: InChIKey of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione is ICPXKFWSKKAXBH-UHFFFAOYSA-N. |
| Q: What is the English name of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione? |
| A: The English name of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione is 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione. |
| Q: What is the polar surface area (PSA) of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione? |
| A: Polar surface area (PSA) of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione is 43.37000. |
| Q: What is the LogP of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione? |
| A: LogP of 4,4,4-trifluoro-1-(4-phenylmethoxyphenyl)butane-1,3-dione is 3.96980. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |