4'-(Benzyloxy) acetophenone structure
|
Common Name | 4'-(Benzyloxy) acetophenone | ||
|---|---|---|---|---|
| CAS Number | 54696-05-8 | Molecular Weight | 226.270 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 378.6±17.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | 91-94 °C | |
| MSDS | N/A | Flash Point | 172.3±14.5 °C | |
| Name | 4'-Benzyloxyacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.6±17.0 °C at 760 mmHg |
| Melting Point | 91-94 °C |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.270 |
| Flash Point | 172.3±14.5 °C |
| Exact Mass | 226.099380 |
| PSA | 26.30000 |
| LogP | 3.39 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | MKYMYZJJFMPDOA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OCc2ccccc2)cc1 |
| Water Solubility | soluble |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4'-(Benzyloxy) acetophenone |
| Ethanone, 1-[4-(phenylmethoxy)phenyl]- |
| 1-(4-phenylmethoxyphenyl)ethanone |
| 1-[4-(Benzyloxy)phenyl]ethanone |
| 4'-(Benzyloxy)-acetophenone |
| MFCD00017247 |