9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene structure
|
Common Name | 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene | ||
|---|---|---|---|---|
| CAS Number | 190071-19-3 | Molecular Weight | 329.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene |
|---|
| Molecular Formula | C21H15NO3 |
|---|---|
| Molecular Weight | 329.34900 |
| Exact Mass | 329.10500 |
| PSA | 55.05000 |
| LogP | 5.69590 |
| InChIKey | LIVLGIRFBZKJEV-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C=C1c2ccccc2-c2ccc([N+](=O)[O-])cc21 |
|
~%
9-[(2-methoxyph... CAS#:190071-19-3 |
| Literature: EMORY UNIVERSITY; BOARD OF REGENTS OF THE UNIVERSITY OF TEXAS SYSTEM; DENG, Xingming; ZHOU, Jia; DING, Chunyong Patent: WO2013/28543 A1, 2013 ; Location in patent: Page/Page column 33; 35 ; |