9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene
![9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene Structure](https://image.chemsrc.com/caspic/313/190071-19-3.png)
9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene structure
|
Common Name | 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene | ||
|---|---|---|---|---|
| CAS Number | 190071-19-3 | Molecular Weight | 329.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H15NO3 |
|---|---|
| Molecular Weight | 329.34900 |
| Exact Mass | 329.10500 |
| PSA | 55.05000 |
| LogP | 5.69590 |
| InChIKey | LIVLGIRFBZKJEV-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C=C1c2ccccc2-c2ccc([N+](=O)[O-])cc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
9-[(2-methoxyph... CAS#:190071-19-3 |
| Literature: EMORY UNIVERSITY; BOARD OF REGENTS OF THE UNIVERSITY OF TEXAS SYSTEM; DENG, Xingming; ZHOU, Jia; DING, Chunyong Patent: WO2013/28543 A1, 2013 ; Location in patent: Page/Page column 33; 35 ; |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene? |
| A: SMILES notation of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene is COc1ccccc1C=C1c2ccccc2-c2ccc([N+](=O)[O-])cc21. |
| Q: What is the CAS number of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene? |
| A: CAS number of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene is 190071-19-3. |
| Q: What is the molecular formula of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene? |
| A: Molecular formula of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene is C21H15NO3. |
| Q: What is the English name of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene? |
| A: The English name of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene is 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene. |
| Q: What is the LogP of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene? |
| A: LogP of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene is 5.69590. |
| Q: What is the InChIKey of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene? |
| A: InChIKey of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene is LIVLGIRFBZKJEV-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 190071-19-3? |
| A: Chinese name of 190071-19-3 is 190071-19-3. |
| Q: What is the polar surface area (PSA) of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene? |
| A: Polar surface area (PSA) of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene is 55.05000. |
| Q: What is the molecular weight of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene? |
| A: Molecular weight of 9-[(2-methoxyphenyl)methylidene]-2-nitrofluorene is 329.34900. |