2-Nitro-9H-fluorene structure
|
Common Name | 2-Nitro-9H-fluorene | ||
|---|---|---|---|---|
| CAS Number | 607-57-8 | Molecular Weight | 211.216 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 374.7±21.0 °C at 760 mmHg | |
| Molecular Formula | C13H9NO2 | Melting Point | 156-158 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 185.2±14.9 °C | |
| Symbol |
GHS08, GHS09 |
Signal Word | Warning | |
| Name | 2-nitrofluorene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.7±21.0 °C at 760 mmHg |
| Melting Point | 156-158 °C(lit.) |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.216 |
| Flash Point | 185.2±14.9 °C |
| Exact Mass | 211.063324 |
| PSA | 45.82000 |
| LogP | 3.89 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | XFOHWECQTFIEIX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)Cc1ccccc1-2 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | Insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H351-H411 |
| Precautionary Statements | P273-P281 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R40;R68 |
| Safety Phrases | S36/37-S61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | LL8225000 |
| Hazard Class | 9.0 |
| HS Code | 29042000 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Genotoxicity testing of esterified propoxylated glycerol (EPG).
Regul Toxicol Pharmacol 70 Suppl 2 , S131-42, (2014) Four versions of esterified propoxylated glycerols (EPGs) were evaluated for potential genotoxicity using a range of in vitro and in vivo assays. H-EPG-05 HR/SO 9:1, H-EPG-05 soyate, and H-EPG-14 soya... |
|
|
Genotoxic properties of representatives of alkylindazoles and aminoalkyl-indoles which are consumed as synthetic cannabinoids.
Food Chem. Toxicol. 80 , 130-6, (2015) Synthetic cannabinoids (SCs) cause similar effects as cannabis and are sold in herbal mixtures. Recent investigations indicate that some of these drugs possess genotoxic properties. Therefore, we test... |
|
|
Safety evaluation of the human-identical milk monosaccharide sialic acid (N-acetyl-d-neuraminic acid) in Sprague-Dawley rats.
Regul Toxicol Pharmacol 70(2) , 482-91, (2014) N-Acetyl-d-neuraminic acid (Neu5Ac) is the predominant form of sialic acid (Sia) in humans, while other mammals express Sia as a mixture with N-glycolyl-d-neuraminic acid (Neu5Gc). Neu5Ac occurs in hi... |
| 2-Nitro-9H-fluorene |
| EINECS 210-138-5 |
| MFCD00001117 |
| 9H-Fluorene, 2-nitro- |
| 2-Nitrofluorene |
| L B656 HHJ ENW |