2-butyloctyl 2-hydroxybenzoate structure
|
Common Name | 2-butyloctyl 2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 190085-41-7 | Molecular Weight | 306.44000 | |
| Density | 0.995g/cm3 | Boiling Point | 392.4ºC at 760 mmHg | |
| Molecular Formula | C19H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.3ºC | |
| Name | 2-butyloctyl 2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.995g/cm3 |
|---|---|
| Boiling Point | 392.4ºC at 760 mmHg |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.44000 |
| Flash Point | 148.3ºC |
| Exact Mass | 306.21900 |
| PSA | 46.53000 |
| LogP | 5.32580 |
| Vapour Pressure | 1.02E-06mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | CZVOIAOPRGNENY-UHFFFAOYSA-N |
| SMILES | CCCCCCC(CCCC)COC(=O)c1ccccc1O |
|
~%
2-butyloctyl 2-... CAS#:190085-41-7 |
| Literature: The C.P. Hall Company Patent: US6350894 B1, 2002 ; Location in patent: Page column 5 ; |
| Benzoic acid,2-hydroxy-,2-butyloctyl ester |
| Butyloctyl salicylate |
| 2-butyloctyl hydroxybenzoate |