Demethoxyencecalin structure
|
Common Name | Demethoxyencecalin | ||
|---|---|---|---|---|
| CAS Number | 19013-07-1 | Molecular Weight | 202.249 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 329.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.7±21.4 °C | |
Use of DemethoxyencecalinDemethoxyencecalin is a chromene isolated from Helianthus annuus, has antifungal activities[1]. |
| Name | 1-(2,2-dimethylchromen-6-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Description | Demethoxyencecalin is a chromene isolated from Helianthus annuus, has antifungal activities[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: antifungal[1] |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 329.8±42.0 °C at 760 mmHg |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.249 |
| Flash Point | 147.7±21.4 °C |
| Exact Mass | 202.099380 |
| PSA | 26.30000 |
| LogP | 3.23 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | ZAJTXVHECZCXLH-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)C=CC(C)(C)O2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914190090 |
| HS Code | 2914190090 |
|---|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,2-Dimethyl-2H-chromene |
| 6-acetyl-2,2-dimethyl-2H-benzo[b]pyran |
| 1-(2,2-Dimethyl-2H-chromen-6-yl)ethanone |
| 6-acetyl-2,2-dimethylchromene |
| 1-(2,2-Dimethylchromen-6-yl)ethan-1-one |
| Desmethoxyencecalin |
| 6-acetyl-2,2-dimethyl-2H-1-benzopyran |
| 2,2-Dimethyl-6-acetyl-2H-1-benzopyran |