4-Methyl-3-nitrobenzoic acid ethyl ester structure
|
Common Name | 4-Methyl-3-nitrobenzoic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 19013-15-1 | Molecular Weight | 209.19900 | |
| Density | 1.217g/cm3 | Boiling Point | 312.38ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.438ºC | |
| Name | Ethyl 4-methyl-3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 312.38ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 137.438ºC |
| Exact Mass | 209.06900 |
| PSA | 72.12000 |
| LogP | 2.60310 |
| Vapour Pressure | 0.001mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | FWOACYVHDUBZDT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| HS Code | 2916399090 |
|---|
|
~95%
4-Methyl-3-nitr... CAS#:19013-15-1 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH; BOYER, Stephen, James; GAO, Donghong, Amy; GUO, Xin; KIRRANE, Thomas, Martin, Jr.; SARKO, Christopher, Ronald; SNOW, Roger, John; SOLEYMANZADEH, Fariba; ZHANG, Yunlong Patent: WO2011/71716 A1, 2011 ; Location in patent: Page/Page column 39-40 ; WO 2011/071716 A1 |
|
~%
4-Methyl-3-nitr... CAS#:19013-15-1 |
| Literature: US6087380 A1, ; US 6087380 A |
|
~97%
4-Methyl-3-nitr... CAS#:19013-15-1 |
| Literature: Desrousseaux; Bennetau; Morand; Mingotaud; Letard; Montant; Freysz New Journal of Chemistry, 2000 , vol. 24, # 12 p. 977 - 985 |
|
~%
4-Methyl-3-nitr... CAS#:19013-15-1 |
| Literature: Journal of the Chinese Chemical Society (Peking), , vol. 14, p. 31,35 |
|
~%
4-Methyl-3-nitr... CAS#:19013-15-1 |
| Literature: New Journal of Chemistry, , vol. 24, # 12 p. 977 - 985 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Methyl-3-nitro-benzoesaeure-aethylester |
| 3-nitro-4-methylbenzoic acid ethyl ester |
| 4-methyl-3-nitro-benzoic acid ethyl ester |
| 4-ethoxycarbonyl-2-nitrotoluene |
| 4-methyl-3-nitroethyl benzoate |
| ethyl 4-methyl-3-nitro-benzoate |
| Benzoic acid,4-methyl-3-nitro-,ethyl ester |
| 4-Methyl-3-nitrobenzoic acid ethyl ester |