4-Methyl-3-nitrobenzoic acid structure
|
Common Name | 4-Methyl-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 96-98-0 | Molecular Weight | 181.15 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 351.4±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | 187-190 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 159.0±13.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 4-Methyl-3-nitrobenzoic acid4-Methyl-3-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 4-Methyl-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 4-Methyl-3-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 351.4±30.0 °C at 760 mmHg |
| Melting Point | 187-190 °C(lit.) |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 |
| Flash Point | 159.0±13.0 °C |
| Exact Mass | 181.037506 |
| PSA | 83.12000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | BBEWSMNRCUXQRF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S36/37/39-S26-S22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Three novel 1D lanthanide-carboxylate polymeric complexes: syntheses, crystal structures and magnetic analyses.
Dalton Trans. 42(23) , 8504-11, (2013) Three novel one-dimensional (1D) lanthanide coordination complexes involving the 4-methyl-3-nitrobenzoic acid (HL) ligand, with the general formulae [Gd(L)3(H2O)(CH3OH)] (1), [Gd(L)3(H2O)2]·(4,4'-bpy)... |
|
Name: Luminescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: mu-type opioid receptor isoform MOR-1 [Homo sapiens]
External Id: OPRM1-OPRD1_AG_LUMI_1536_1X%ACT PRUN
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_AG_FLUO8_1536_1X%ACT PRUN
|
|
Name: Cytochrome P450 Family 1 Subfamily A Member 2 (CYP1A2) small molecule antagonists: lu...
Source: 824
External Id: CYP273
|
|
Name: Primary Screen Inhibitors of CD40 Signaling in BL2 Cells Measured in Cell-Based Syste...
Source: Broad Institute
Target: N/A
External Id: 7124-01_Inhibitor_SinglePoint_HTS_Activity
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify pos...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_PAM_FLUO8_1536_1X%ACT PRUN
|
|
Name: Fluorescence polarization-based biochemical high throughput primary assay to identify...
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=Sialate O-acetylesterase; AltName: Full=H-Lse; AltName: Full=Sialic acid-specific 9-O-acetylesterase; Flags: Precursor [Homo sapiens]
External Id: SIAE_INH_FP_1536_1X%INH PRUN
|
|
Name: p53 small molecule agonists, cell-based qHTS assay: qHTS cell viability counter scree...
Source: 824
Target: N/A
External Id: P53600
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: qHTS ce...
Source: 824
Target: N/A
External Id: P53MS958
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: Summary
Source: 824
External Id: P53MS482
|
| 3-Nitro-p-toluylsaeure |
| EINECS 202-549-3 |
| p-Toluic acid,3-nitro |
| 3-Nitro-p-toluic acid |
| 4-Methyl-3-nitrobenzoic acid |
| Benzoic acid,4-methyl-3-nitro |
| 3-nitro-4-methylbenzoic acid |
| 4-Methyl-3-nitro-benzoesaeure |
| 4-methyl-3-nitrobenzoicacid |
| m-Nitro-p-toluic acid |
| MFCD00007174 |
| 3-Nitro-para-toluic acid |