Acetamide,N,N-bis(2-methylphenyl)- structure
|
Common Name | Acetamide,N,N-bis(2-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 19020-41-8 | Molecular Weight | 239.31200 | |
| Density | 1.086g/cm3 | Boiling Point | 430.1ºC at 760 mmHg | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.8ºC | |
| Name | N-acetyl-2,2'-dimethyldiphenylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.086g/cm3 |
|---|---|
| Boiling Point | 430.1ºC at 760 mmHg |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 203.8ºC |
| Exact Mass | 239.13100 |
| PSA | 20.31000 |
| LogP | 3.98800 |
| Vapour Pressure | 1.34E-07mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | KGWATDMFVRIHKI-UHFFFAOYSA-N |
| SMILES | CC(=O)N(c1ccccc1C)c1ccccc1C |
|
~37%
Acetamide,N,N-b... CAS#:19020-41-8 |
| Literature: Kulagowski, Janusz J.; Moody, Christopher J.; Rees, Charles W. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 2725 - 2732 |
|
~%
Acetamide,N,N-b... CAS#:19020-41-8 |
| Literature: Battegay; Silberman; Fischer Chim.et Ind.Sonderband 11.Congr.Chim.ind. Paris 1931 S.525 |
| N,N-di-o-tolyl-acetamide |
| N,N-Di-o-tolyl-acetamid |
| Dioleylamine |
| N,N-dioleylamine |
| N-Acetyl-2,2'-dimethyl-diphenylamin |