1,8-DiMethylacarbazole
1,8-DiMethylacarbazole structure
|
Common Name | 1,8-DiMethylacarbazole | ||
|---|---|---|---|---|
| CAS Number | 6558-83-4 | Molecular Weight | 195.26000 | |
| Density | 1.158±0.06 g/cm3 (20 C 760 Torr) | Boiling Point | 383.0±11.0 °C(Predicted) | |
| Molecular Formula | C14H13N | Melting Point | 178-180°C | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1,8-dimethyl-9H-carbazole, also known as 1,8-DiMethylacarbazole, has a CAS number of 6558-83-4, with a molecular formula of C14H13N and a molecular weight of 195.26000. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,8-dimethyl-9H-carbazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.158±0.06 g/cm3 (20 C 760 Torr) |
|---|---|
| Boiling Point | 383.0±11.0 °C(Predicted) |
| Melting Point | 178-180°C |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26000 |
| Exact Mass | 195.10500 |
| PSA | 15.79000 |
| LogP | 3.93790 |
| InChIKey | NAXSBBMMIDFGHQ-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c1[nH]c1c(C)cccc12 |
| Storage condition | 2-8°C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
CAS#:95-46-5
CAS#:87-63-8
CAS#:28035-56-5
CAS#:38514-89-5
CAS#:87-62-7
CAS#:82757-38-8
CAS#:583-60-8
CAS#:529-27-1
CAS#:120-66-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,8-Dimethyl-carbazol |
| 1,8-dimethyl-carbazole |
| 9H-Carbazole,1,8-dimethyl |
| 1,8-DiMethylacarbazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,8-dimethyl-9H-carbazole? |
| A: SMILES notation of 1,8-dimethyl-9H-carbazole is Cc1cccc2c1[nH]c1c(C)cccc12. |
| Q: What is the English name of 1,8-dimethyl-9H-carbazole? |
| A: The English name of 1,8-dimethyl-9H-carbazole is 1,8-dimethyl-9H-carbazole. |
| Q: What English synonyms does 1,8-dimethyl-9H-carbazole have? |
| A: English synonyms of 1,8-dimethyl-9H-carbazole: 1,8-Dimethyl-carbazol, 1,8-dimethyl-carbazole, 9H-Carbazole,1,8-dimethyl, 1,8-DiMethylacarbazole. |
| Q: What is the boiling point of 1,8-dimethyl-9H-carbazole? |
| A: Boiling point of 1,8-dimethyl-9H-carbazole is 383.0±11.0 °C(Predicted). |
| Q: What is the melting point of 1,8-dimethyl-9H-carbazole? |
| A: Melting point of 1,8-dimethyl-9H-carbazole is 178-180°C. |
| Q: What is the polar surface area (PSA) of 1,8-dimethyl-9H-carbazole? |
| A: Polar surface area (PSA) of 1,8-dimethyl-9H-carbazole is 15.79000. |
| Q: What is the molecular weight of 1,8-dimethyl-9H-carbazole? |
| A: Molecular weight of 1,8-dimethyl-9H-carbazole is 195.26000. |
| Q: What is the CAS number of 1,8-dimethyl-9H-carbazole? |
| A: CAS number of 1,8-dimethyl-9H-carbazole is 6558-83-4. |
| Q: What is the molecular formula of 1,8-dimethyl-9H-carbazole? |
| A: Molecular formula of 1,8-dimethyl-9H-carbazole is C14H13N. |
| Q: What is the InChIKey of 1,8-dimethyl-9H-carbazole? |
| A: InChIKey of 1,8-dimethyl-9H-carbazole is NAXSBBMMIDFGHQ-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |