Adamantan-1-yl-acetic acid hydrazide structure
|
Common Name | Adamantan-1-yl-acetic acid hydrazide | ||
|---|---|---|---|---|
| CAS Number | 19026-80-3 | Molecular Weight | 208.30000 | |
| Density | 1.148 g/cm3 | Boiling Point | 389ºC at 760 mmHg | |
| Molecular Formula | C12H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.1ºC | |
| Name | 2-(1-adamantyl)acetohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148 g/cm3 |
|---|---|
| Boiling Point | 389ºC at 760 mmHg |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30000 |
| Flash Point | 189.1ºC |
| Exact Mass | 208.15800 |
| PSA | 55.12000 |
| LogP | 2.67400 |
| Vapour Pressure | 2.93E-06mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | ZORPHDZMMHDLAM-UHFFFAOYSA-N |
| SMILES | NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2928000090 |
|
~%
Adamantan-1-yl-... CAS#:19026-80-3 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 41, # 1 p. 238 - 240 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Adamantan-1-acetohydrazid |
| F0020-1635 |
| Adamantyl-1-acetohydrazid |
| Adamantan-1-yl-acetic acid hydrazide |
| 1-admantaneacetic acid hydrazide |
| 2,6-DIBROMO-4-METHYLPYRIDINE-1-OXIDE |
| 2-adamantanylacetohydrazide |
| MFCD00185799 |