4-(chloromethyl)-7,8-dihydroxy-2-benzopyrone structure
|
Common Name | 4-(chloromethyl)-7,8-dihydroxy-2-benzopyrone | ||
|---|---|---|---|---|
| CAS Number | 19040-71-2 | Molecular Weight | 226.61300 | |
| Density | 1.569g/cm3 | Boiling Point | 451.7ºC at 760mmHg | |
| Molecular Formula | C10H7ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227ºC | |
| Name | 4-(chloromethyl)-7,8-dihydroxychromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.569g/cm3 |
|---|---|
| Boiling Point | 451.7ºC at 760mmHg |
| Molecular Formula | C10H7ClO4 |
| Molecular Weight | 226.61300 |
| Flash Point | 227ºC |
| Exact Mass | 226.00300 |
| PSA | 70.67000 |
| LogP | 1.94300 |
| Vapour Pressure | 8.92E-09mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | DISLGKNXGGQKTE-UHFFFAOYSA-N |
| SMILES | O=c1cc(CCl)c2ccc(O)c(O)c2o1 |
| HS Code | 2932209090 |
|---|
|
~98%
4-(chloromethyl... CAS#:19040-71-2 |
| Literature: Sharma; Janardhan Reddy; Sree Lakshmi; Radha Krishna Tetrahedron Letters, 2005 , vol. 46, # 36 p. 6119 - 6121 |
|
~90%
4-(chloromethyl... CAS#:19040-71-2 |
| Literature: Sharghi, Hashem; Jokar, Mahboubeh Heterocycles, 2007 , vol. 71, # 12 p. 2721 - 2733 |
|
~65%
4-(chloromethyl... CAS#:19040-71-2 |
| Literature: Campos-Toimil, Manuel; Orallo, Francisco; Santana, Lourdes; Uriarte, Eugenio Bioorganic and Medicinal Chemistry Letters, 2002 , vol. 12, # 5 p. 783 - 786 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(chloromethyl)-5,7-dihydroxy-2H-chromen-2-one |
| 4-chloromethyl-7,8-dihydroxycoumarin |
| BB_NC-2140 |
| 4-chloromethyldaphnetin |
| 4-(Chloromethyl)-7,8-dihydroxy-2-benzopyrone |
| 4-chloromethyl-7,8-dihydroxy<1>benzopyran-2(H)-one |
| 4-chloromethyl-7,8-dihydroxy-chromen-2-one |
| 4-(chloromethyl)-7,8-dihydroxy-2H-chromen-2-one |