2-amino-N-[(4-methoxyphenyl)methylideneamino]benzamide structure
|
Common Name | 2-amino-N-[(4-methoxyphenyl)methylideneamino]benzamide | ||
|---|---|---|---|---|
| CAS Number | 19050-68-1 | Molecular Weight | 269.29900 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.29900 |
| Exact Mass | 269.11600 |
| PSA | 76.71000 |
| LogP | 3.01340 |
| Index of Refraction | 1.593 |
| InChIKey | OXDPIJOVGNEYBT-LICLKQGHSA-N |
| SMILES | COc1ccc(C=NNC(=O)c2ccccc2N)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
2-amino-N-[(4-m... CAS#:19050-68-1 |
| Literature: Agarwal, Suresh K.; Gupta, Rajiva; Kumar, Dinesh Polish Journal of Chemistry, 1989 , vol. 63, # 4-12 p. 329 - 335 |
|
~%
2-amino-N-[(4-m... CAS#:19050-68-1 |
| Literature: Fueloep, Ferenc; Simeonov, Mario; Pihlaja, Kalevi Tetrahedron, 1992 , vol. 48, # 3 p. 531 - 538 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-amino-benzoic acid (4-methoxy-benzylidene)-hydrazide |
| anisylidene anthranilic acid hydrazide |
| N-Anthraniloyl-N'-(p-methoxy-benzyliden)-hydrazin |