2-Acetyl-3,5-dihydroxyphenylacetic acid structure
|
Common Name | 2-Acetyl-3,5-dihydroxyphenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 19053-94-2 | Molecular Weight | 210.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of 2-Acetyl-3,5-dihydroxyphenylacetic acidCurvulinic acid is a phytotoxic compound, has herbicidal activity[1]. |
| Name | 2-(3,5-dihydroxyphenyl)-3-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Curvulinic acid is a phytotoxic compound, has herbicidal activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | The activity of Curvulinic acid on seed germination and seedling growth of Capsella bursa-pastoris is evaluated. Curvulinic acid has stronger inhibitory effects on root length than shoot length[1]. |
| References |
| Molecular Formula | C10H10O5 |
|---|---|
| Molecular Weight | 210.18300 |
| Exact Mass | 210.05300 |
| PSA | 94.83000 |
| LogP | 0.85500 |
| InChIKey | JAHPPWGWEUVLMS-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(O)cc(O)cc1CC(=O)O |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Curvulinsaeure |
| 2-Acetyl-3,5-dihydroxyphenylacetic acid |
| curvulinic acid |