Phenol, 2,5-dimethyl-,1,1',1''-phosphate structure
|
Common Name | Phenol, 2,5-dimethyl-,1,1',1''-phosphate | ||
|---|---|---|---|---|
| CAS Number | 19074-59-0 | Molecular Weight | 410.44300 | |
| Density | 1.154g/cm3 | Boiling Point | 460.1ºC at 760mmHg | |
| Molecular Formula | C24H27O4P | Melting Point | 79.8ºC | |
| MSDS | N/A | Flash Point | 245.3ºC | |
| Name | tris(2,5-dimethylphenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 460.1ºC at 760mmHg |
| Melting Point | 79.8ºC |
| Molecular Formula | C24H27O4P |
| Molecular Weight | 410.44300 |
| Flash Point | 245.3ºC |
| Exact Mass | 410.16500 |
| PSA | 54.57000 |
| LogP | 7.18190 |
| Vapour Pressure | 3.28E-08mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | MDHAARLWBHZGIP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(OP(=O)(Oc2cc(C)ccc2C)Oc2cc(C)ccc2C)c1 |
| HS Code | 2919900090 |
|---|
|
~%
Phenol, 2,5-dim... CAS#:19074-59-0 |
| Literature: Breusch; Keskin Istanbul Universitesi Fen Fakultesi Mecmuasi, 1942 , vol. 7, p. 182,187 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Tri(2,5-xylenyl)phosphate |
| phosphoric acid tris-(2,5-dimethyl-phenyl ester) |
| Tri(2,5-dimethylphenyl) phosphate |
| Phosphorsaeure-tri-[2.5]xylylester |
| 2,5-Xylenol,phosphate (3:1) |
| Tri-[2.5]xylyl-phosphat |
| phosphoric acid 2,5-xylyl ester |
| Phosphorsaeure-tris-(2,5-dimethyl-phenylester) |
| Tris-(2.5-dimethyl-phenyl)-phosphat |
| 2,5-dimethyl-phenol |
| Tris(2,5-xylyl) phosphate |