Phenol, 3,5-dimethyl-,1,1',1''-phosphate structure
|
Common Name | Phenol, 3,5-dimethyl-,1,1',1''-phosphate | ||
|---|---|---|---|---|
| CAS Number | 25653-16-1 | Molecular Weight | 410.44300 | |
| Density | 1.154g/cm3 | Boiling Point | 490.8ºC at 760mmHg | |
| Molecular Formula | C24H27O4P | Melting Point | 46ºC | |
| MSDS | N/A | Flash Point | 263.8ºC | |
| Name | tris(3,5-dimethylphenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 490.8ºC at 760mmHg |
| Melting Point | 46ºC |
| Molecular Formula | C24H27O4P |
| Molecular Weight | 410.44300 |
| Flash Point | 263.8ºC |
| Exact Mass | 410.16500 |
| PSA | 54.57000 |
| LogP | 7.18190 |
| InChIKey | LLPMAOBOEQFPRE-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(OP(=O)(Oc2cc(C)cc(C)c2)Oc2cc(C)cc(C)c2)c1 |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| EINECS 247-165-7 |
| Tris-<3,5-dimethyl-phenyl>-phosphat |
| phosphoric acid 3,5-xylyl ester |
| 3,5-dimethyl-phenol |
| Trixylenyl phosphate mixed isomers |