2-(3-Aminophenylsulfonyl)ethanol hydrochloride structure
|
Common Name | 2-(3-Aminophenylsulfonyl)ethanol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 19076-03-0 | Molecular Weight | 237.70400 | |
| Density | N/A | Boiling Point | 487.7ºC at 760 mmHg | |
| Molecular Formula | C8H12ClNO3S | Melting Point | 210ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 248.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(3-Aminophenylsulfonyl)ethanol hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 487.7ºC at 760 mmHg |
|---|---|
| Melting Point | 210ºC (dec.)(lit.) |
| Molecular Formula | C8H12ClNO3S |
| Molecular Weight | 237.70400 |
| Flash Point | 248.8ºC |
| Exact Mass | 237.02300 |
| PSA | 88.77000 |
| LogP | 2.49880 |
| Vapour Pressure | 2.51E-10mmHg at 25°C |
| InChIKey | VTZPDMOWNKSUSG-UHFFFAOYSA-N |
| SMILES | Cl.Nc1cccc(S(=O)(=O)CCO)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2922199090 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00134194 |
| 2-(3-aminophenyl)sulfonylethanol,hydrochloride |