methyl 2-(2,5-dioxopyrrol-1-yl)benzoate structure
|
Common Name | methyl 2-(2,5-dioxopyrrol-1-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 19077-61-3 | Molecular Weight | 231.20400 | |
| Density | 1.375g/cm3 | Boiling Point | 380.1ºC at 760 mmHg | |
| Molecular Formula | C12H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.7ºC | |
| Name | methyl 2-(2,5-dioxopyrrol-1-yl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 380.1ºC at 760 mmHg |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.20400 |
| Flash Point | 183.7ºC |
| Exact Mass | 231.05300 |
| PSA | 63.68000 |
| LogP | 0.96760 |
| Vapour Pressure | 5.59E-06mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | LCWKOBRYDWGUOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1N1C(=O)C=CC1=O |
| HS Code | 2925190090 |
|---|
|
~%
methyl 2-(2,5-d... CAS#:19077-61-3 |
| Literature: Chen, Hai-Jun; Liu, Yong; Wang, Li-Na; Shen, Qiang; Li, Jia; Nan, Fa-Jun Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 9 p. 2876 - 2879 |
|
~%
methyl 2-(2,5-d... CAS#:19077-61-3 |
| Literature: Balasubramaniyan, V.; Argade, N. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1987 , vol. 26, # 1-12 p. 476 - 477 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| f1751-0015 |