HBPipU
HBPipU structure
|
Common Name | HBPipU | ||
|---|---|---|---|---|
| CAS Number | 190849-64-0 | Molecular Weight | 459.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24F6N5OP | Melting Point | 206ºC (DEC.) | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 206ºC (DEC.) |
|---|---|
| Molecular Formula | C17H24F6N5OP |
| Molecular Weight | 459.37000 |
| Exact Mass | 459.16200 |
| PSA | 60.01000 |
| LogP | 5.53690 |
| Appearance of Characters | Powder | White to off-white |
| InChIKey | YNOBMGHLCWIWCL-UHFFFAOYSA-N |
| SMILES | F[P-](F)(F)(F)(F)F.c1ccc2c(c1)nnn2OC(N1CCCCC1)=[N+]1CCCCC1 |
| Storage condition | 2-8°C |
| Water Solubility | acetonitrile: 0.1 g/mL, clear |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (1H-Benzotriazol-1-yloxy)[di(piperidin-1-yl)]methylium hexafluorophosphate |
| HBPipU (Benzotriazol-1-yloxy)dipiperidinocarbeniuM hexafluorophosp |
| O-(BENZOTRIAZOL-1-YL)-N,N,N',N'-BIS(PENTAMETHYLENE)URONIUM HEXAFLUOROPHOSPHATE |
| O-(Benzotriazol-1-yl)-N,N,N',N'-bis(pentamethylene |
| (Benzotriazol-1-yloxy)dipiperidinocarbeniumhexafluorophosphate |
| (1H-Benzotriazol-1-yloxy)(di-1-piperidinyl)methylium hexafluorophosphate |
| HBPIPU (BENZOTRIAZOL-1-YLOXY)DIPIPERIDINOCARBENIUM HEXAFLUOROPHOSPHATE |
| O-(Benzotriazol-1-Yloxy)Dipiperidinocarbeniumhexafluorophosphate |
| (Benzotriazol-1-yloxy)dipiperidinocarbenium HexafluorophosphateHBPipU |
| HBPIPU |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: How is the water solubility of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate? |
| A: Water solubility of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate: acetonitrile: 0.1 g/mL, clear. |
| Q: What is the safety information for (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate? |
| A: Safety information for (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate: S26-S36. |
| Q: What is the SMILES notation of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate? |
| A: SMILES notation of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate is F[P-](F)(F)(F)(F)F.c1ccc2c(c1)nnn2OC(N1CCCCC1)=[N+]1CCCCC1. |
| Q: What is the molecular formula of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate? |
| A: Molecular formula of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate is C17H24F6N5OP. |
| Q: What is the InChIKey of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate? |
| A: InChIKey of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate is YNOBMGHLCWIWCL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate? |
| A: Molecular weight of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate is 459.37000. |
| Q: What are the storage conditions for (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate? |
| A: Storage conditions for (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate: 2-8°C. |
| Q: What is the LogP of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate? |
| A: LogP of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate is 5.53690. |
| Q: What is the polar surface area (PSA) of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate? |
| A: Polar surface area (PSA) of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate is 60.01000. |
| Q: What is the English name of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate? |
| A: The English name of (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate is (Benzotriazol-1-yloxy)dipiperidinocarbenium hexafluorophosphate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |