3-tert-Butoxycarbonylamino-2-methyl-propionic acid structure
|
Common Name | 3-tert-Butoxycarbonylamino-2-methyl-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 190897-47-3 | Molecular Weight | 203.236 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 339.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H17NO4 | Melting Point | 88ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 159.1±23.2 °C | |
| Name | (2S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 339.5±25.0 °C at 760 mmHg |
| Melting Point | 88ºC(lit.) |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.236 |
| Flash Point | 159.1±23.2 °C |
| Exact Mass | 203.115753 |
| PSA | 75.63000 |
| LogP | 1.27 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | GDQRNRYMFXDGMS-LURJTMIESA-N |
| SMILES | CC(CNC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924199090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
M. Rueping et al.
Helv. Chim. Acta 85 , 2577, (2002)
|
|
|
D. Seebach et al.
Helv. Chim. Acta 81 , 932, (1998)
|
| (2S)-3-[(tert-butoxycarbonyl)amino]-2-methylpropanoic acid |
| (s)-3-(boc-amino)-2-methylpropionic acid |
| 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| (s)-n-t-butyloxycarbonyl-3-amino-2-methyl propionic acid |
| MFCD04040045 |
| 3-[(tert-Butoxycarbonyl)amino]-2-methylpropanoic acid |
| boc-s-ampa-oh |
| 3-tert-Butoxycarbonylamino-2-methyl-propionic acid |
| boc-s-3-aminoisobutyric acid |
| (2S)-2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |