2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride
Modify Date: 2026-09-27 16:00:49
2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride structure
|
Common Name | 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1909317-06-1 | Molecular Weight | 289.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13Cl2F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13Cl2F3N2 |
|---|---|
| Molecular Weight | 289.12 |
| InChIKey | PLVUAGRLHYLABF-UHFFFAOYSA-N |
| SMILES | Cl.Cl.FC(F)(F)c1ccnc(C2CCNC2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride? |
| A: InChIKey of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride is PLVUAGRLHYLABF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride? |
| A: SMILES notation of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride is Cl.Cl.FC(F)(F)c1ccnc(C2CCNC2)c1. |
| Q: What is the Chinese name of 1909317-06-1? |
| A: Chinese name of 1909317-06-1 is 1909317-06-1. |
| Q: What is the molecular formula of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride? |
| A: Molecular formula of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride is C10H13Cl2F3N2. |
| Q: What is the molecular weight of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride? |
| A: Molecular weight of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride is 289.12. |
| Q: What is the CAS number of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride? |
| A: CAS number of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride is 1909317-06-1. |
| Q: What is the English name of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride? |
| A: The English name of 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride is 2-(Pyrrolidin-3-yl)-4-(trifluoromethyl)pyridine dihydrochloride. |