7(8H)-Pteridinone,2,4-diamino-6-methyl- structure
|
Common Name | 7(8H)-Pteridinone,2,4-diamino-6-methyl- | ||
|---|---|---|---|---|
| CAS Number | 19152-92-2 | Molecular Weight | 192.17800 | |
| Density | 1.97g/cm3 | Boiling Point | 610ºC at 760mmHg | |
| Molecular Formula | C7H8N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.7ºC | |
| Name | 2,4-diamino-6-methyl-8H-pteridin-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.97g/cm3 |
|---|---|
| Boiling Point | 610ºC at 760mmHg |
| Molecular Formula | C7H8N6O |
| Molecular Weight | 192.17800 |
| Flash Point | 322.7ºC |
| Exact Mass | 192.07600 |
| PSA | 123.57000 |
| LogP | 0.34830 |
| Vapour Pressure | 1.79E-15mmHg at 25°C |
| Index of Refraction | 1.936 |
| InChIKey | HJIYAWDHZICEAC-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(N)nc(N)nc2[nH]c1=O |
| HS Code | 2933990090 |
|---|
|
~84%
7(8H)-Pteridino... CAS#:19152-92-2 |
| Literature: Neilsen; Broadbent; Hennen Journal of Heterocyclic Chemistry, 1987 , vol. 24, # 6 p. 1621 - 1628 |
|
~%
7(8H)-Pteridino... CAS#:19152-92-2 |
| Literature: Elion et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 78,79 |
|
~%
7(8H)-Pteridino... CAS#:19152-92-2 |
| Literature: Neilsen; Broadbent; Hennen Journal of Heterocyclic Chemistry, 1987 , vol. 24, # 6 p. 1621 - 1628 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-diamino-6-methyl-7(8H)-pteridinone |
| 2,4-Diamino-6-methyl-7-hydroxypteridine |
| 7(8H)-Pteridinone,2,4-diamino-6-methyl |
| 2,4-Diamino-6-methyl-8H-pteridin-7-on |
| 2,4-Dmhpt |