2-amino-6-methyl-1,8-dihydropteridine-4,7-dione structure
|
Common Name | 2-amino-6-methyl-1,8-dihydropteridine-4,7-dione | ||
|---|---|---|---|---|
| CAS Number | 712-38-9 | Molecular Weight | 193.16300 | |
| Density | 1.97g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H7N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-6-methyl-1,8-dihydropteridine-4,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.97g/cm3 |
|---|---|
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.16300 |
| Exact Mass | 193.06000 |
| PSA | 118.04000 |
| LogP | 0.30280 |
| Index of Refraction | 1.898 |
| InChIKey | DYXQYFTUVSIKIG-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(=O)[nH]c(N)nc2[nH]c1=O |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-amino-6-methyl-3H,8H-pteridine-4,7-dione |
| 2-AMINO-4,7-DIHYDROXY-6-METHYLPTERIDINE |
| 6-methylisoxanthopterin |
| 2-Amino-4,7-dioxo-6-methyl-tetrahydropteridin |
| 2-Amino-6-methyl-3H,8H-pteridin-4,7-dion |
| 2-amino-6-methylpteridine-4,7-diol |