2,4-Diamino-6-phenyl-7-pteridinol structure
|
Common Name | 2,4-Diamino-6-phenyl-7-pteridinol | ||
|---|---|---|---|---|
| CAS Number | 19152-93-3 | Molecular Weight | 254.24700 | |
| Density | 1.69g/cm3 | Boiling Point | 634.2ºC at 760mmHg | |
| Molecular Formula | C12H10N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4-Diamino-6-phenyl-7-pteridinol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.69g/cm3 |
|---|---|
| Boiling Point | 634.2ºC at 760mmHg |
| Molecular Formula | C12H10N6O |
| Molecular Weight | 254.24700 |
| Flash Point | 337.3ºC |
| Exact Mass | 254.09200 |
| PSA | 123.83000 |
| LogP | 2.11920 |
| Vapour Pressure | 1.12E-16mmHg at 25°C |
| Index of Refraction | 1.851 |
| InChIKey | USTXKGPQJJRCTO-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2nc(-c3ccccc3)c(=O)[nH]c2n1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Diamino-7-hydroxy-6-phenylpteridine |
| Triamterene Related Compound C |
| 2,4-diamino-6-phenyl-8H-pteridin-7-one |